Alternative Name
Ethyl cellulose | 9004-57-3 | 2-[4,5-diethoxy-2-(ethoxymethyl)-6-methoxyoxan-3-yl]oxy-6-(hydroxymethyl)-5-methoxyoxane-3,4-diol | Ethylcellulose | Aquacoat | Ethocel | Surelease | Cellulose ethyl | Ethocel MED | Ethocel STD | Cellulose ethylate | Triethyl cellulose | Ethocel E7 |
Other Properties
Solubility: Soluble in tetrahydrofuran, methyl acetate, ethanol, methanol, toluene, ethyl acetate, chloroform, esters, aromatic hydrocarbons, alcohols and ketones. Insoluble in water, glycerol and propane-1,2-diol.
Sensitivity: Hygroscopic.
Refractive Index: 1.47
InChi
InChI=1S/C20H38O11/c1-6-26-10-12-16(17(27-7-2)18(28-8-3)20(25-5)30-12)31-19-14(23)13(22)15(24-4)11(9-21)29-19/h11-23H,6-10H2,1-5H3
Others
IUPAC Name: 2-[4,5-diethoxy-2-(ethoxymethyl)-6-methoxyoxan-3-yl]oxy-6-(hydroxymethyl)-5-methoxyoxane-3,4-diol
RTECS: FJ5950500